C19H23NS — CID 25002514
(E)-N-[(1R)-1-(1-benzothiophen-3-yl)ethyl]-6,6-dimethylhept-2-en-4-yn-1-amine (PubChem CID 25002514) has the molecular formula C19H23NS and a molecular weight of 297.47 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(1-benzothiophen-3-yl)ethyl]-6,6-dimethylhept-2-en-4-yn-1-amine.
| Compound Name | (E)-N-[(1R)-1-(1-benzothiophen-3-yl)ethyl]-6,6-dimethylhept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 25002514 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (E)-N-[(1R)-1-(1-benzothiophen-3-yl)ethyl]-6,6-dimethylhept-2-en-4-yn-1-amine |
| SMILES | C[C@@H](NC/C=C/C#CC(C)(C)C)c1csc2ccccc12 |
| InChI | InChI=1S/C19H23NS/c1-15(20-13-9-5-8-12-19(2,3)4)17-14-21-18-11-7-6-10-16(17)18/h5-7,9-11,14-15,20H,13H2,1-4H3/b9-5+/t15-/m1/s1 |
| InChIKey | ASEOKDCUTYYDQW-FUVBFXSKSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|