C18H19NOS2 — CID 97031531
(1R)-1-(1-benzothiophen-3-yl)-N-[[4-[(R)-methylsulfinyl]phenyl]methyl]ethanamine (PubChem CID 97031531) has the molecular formula C18H19NOS2 and a molecular weight of 329.49 g/mol. Its IUPAC name is (1R)-1-(1-benzothiophen-3-yl)-N-[[4-[(R)-methylsulfinyl]phenyl]methyl]ethanamine.
| Compound Name | (1R)-1-(1-benzothiophen-3-yl)-N-[[4-[(R)-methylsulfinyl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 97031531 |
| Molecular Formula | C18H19NOS2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (1R)-1-(1-benzothiophen-3-yl)-N-[[4-[(R)-methylsulfinyl]phenyl]methyl]ethanamine |
| SMILES | C[C@@H](NCc1ccc([S@@](C)=O)cc1)c1csc2ccccc12 |
| InChI | InChI=1S/C18H19NOS2/c1-13(17-12-21-18-6-4-3-5-16(17)18)19-11-14-7-9-15(10-8-14)22(2)20/h3-10,12-13,19H,11H2,1-2H3/t13-,22-/m1/s1 |
| InChIKey | GIJUIGHJKVNOFQ-MCMMXHMISA-N |
| XLogP | 4.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |