C23H20BrN — CID 25006403
(E)-5-(4-bromophenyl)-N-(1-naphthalen-1-ylethyl)pent-2-en-4-yn-1-amine (PubChem CID 25006403) has the molecular formula C23H20BrN and a molecular weight of 390.32 g/mol. Its IUPAC name is (E)-5-(4-bromophenyl)-N-(1-naphthalen-1-ylethyl)pent-2-en-4-yn-1-amine.
| Compound Name | (E)-5-(4-bromophenyl)-N-(1-naphthalen-1-ylethyl)pent-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 25006403 |
| Molecular Formula | C23H20BrN |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | (E)-5-(4-bromophenyl)-N-(1-naphthalen-1-ylethyl)pent-2-en-4-yn-1-amine |
| SMILES | CC(NC/C=C/C#Cc1ccc(Br)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H20BrN/c1-18(22-12-7-10-20-9-4-5-11-23(20)22)25-17-6-2-3-8-19-13-15-21(24)16-14-19/h2,4-7,9-16,18,25H,17H2,1H3/b6-2+ |
| InChIKey | WGDCZHCYMWZSHX-QHHAFSJGSA-N |
| XLogP | 5.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|