C23H21N — CID 91425181
N-[(1R)-1-naphthalen-1-ylethyl]-5-phenylpent-2-en-4-yn-1-amine (PubChem CID 91425181) has the molecular formula C23H21N and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(1R)-1-naphthalen-1-ylethyl]-5-phenylpent-2-en-4-yn-1-amine.
| Compound Name | N-[(1R)-1-naphthalen-1-ylethyl]-5-phenylpent-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 91425181 |
| Molecular Formula | C23H21N |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-[(1R)-1-naphthalen-1-ylethyl]-5-phenylpent-2-en-4-yn-1-amine |
| SMILES | C[C@@H](NCC=CC#Cc1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H21N/c1-19(22-17-10-15-21-14-7-8-16-23(21)22)24-18-9-3-6-13-20-11-4-2-5-12-20/h2-5,7-12,14-17,19,24H,18H2,1H3/t19-/m1/s1 |
| InChIKey | OBALFMSYRPCEQH-LJQANCHMSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|