C28H34N2O — CID 91408569
N-[2,2-dimethyl-7-[[(1R)-1-naphthalen-1-ylethyl]amino]hept-5-en-3-ynyl]cyclohex-3-ene-1-carboxamide (PubChem CID 91408569) has the molecular formula C28H34N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is N-[2,2-dimethyl-7-[[(1R)-1-naphthalen-1-ylethyl]amino]hept-5-en-3-ynyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[2,2-dimethyl-7-[[(1R)-1-naphthalen-1-ylethyl]amino]hept-5-en-3-ynyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 91408569 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | N-[2,2-dimethyl-7-[[(1R)-1-naphthalen-1-ylethyl]amino]hept-5-en-3-ynyl]cyclohex-3-ene-1-carboxamide |
| SMILES | C[C@@H](NCC=CC#CC(C)(C)CNC(=O)C1CC=CCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H34N2O/c1-22(25-18-12-16-23-13-8-9-17-26(23)25)29-20-11-5-10-19-28(2,3)21-30-27(31)24-14-6-4-7-15-24/h4-6,8-9,11-13,16-18,22,24,29H,7,14-15,20-21H2,1-3H3,(H,30,31)/t22-,24?/m1/s1 |
| InChIKey | DFNHCKGPXPDUEP-LETIRJCYSA-N |
| XLogP | 5.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|