C24H30N2O — CID 89013909
N-[(E)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enyl]pent-4-ynamide (PubChem CID 89013909) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is N-[(E)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enyl]pent-4-ynamide.
| Compound Name | N-[(E)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enyl]pent-4-ynamide |
|---|---|
| PubChem CID | 89013909 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | N-[(E)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enyl]pent-4-ynamide |
| SMILES | C#CCCC(=O)NCC(C)(C)/C=C/CN[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H30N2O/c1-5-6-15-23(27)26-18-24(3,4)16-10-17-25-19(2)21-14-9-12-20-11-7-8-13-22(20)21/h1,7-14,16,19,25H,6,15,17-18H2,2-4H3,(H,26,27)/b16-10+/t19-/m1/s1 |
| InChIKey | HENIKRUKBAZQJM-OUQXZNHLSA-N |
| XLogP | 4.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|