C22H22F3N — CID 118703628
(E)-N-[(1R)-1-naphthalen-1-ylethyl]-3-[5-(trifluoromethyl)cyclohexa-1,4-dien-1-yl]prop-2-en-1-amine (PubChem CID 118703628) has the molecular formula C22H22F3N and a molecular weight of 357.42 g/mol. Its IUPAC name is (E)-N-[(1R)-1-naphthalen-1-ylethyl]-3-[5-(trifluoromethyl)cyclohexa-1,4-dien-1-yl]prop-2-en-1-amine.
| Compound Name | (E)-N-[(1R)-1-naphthalen-1-ylethyl]-3-[5-(trifluoromethyl)cyclohexa-1,4-dien-1-yl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 118703628 |
| Molecular Formula | C22H22F3N |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (E)-N-[(1R)-1-naphthalen-1-ylethyl]-3-[5-(trifluoromethyl)cyclohexa-1,4-dien-1-yl]prop-2-en-1-amine |
| SMILES | C[C@@H](NC/C=C/C1=CCC=C(C(F)(F)F)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H22F3N/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25/h2-3,5-13,16,26H,4,14-15H2,1H3/b8-6+/t16-/m1/s1 |
| InChIKey | XYUDKRQKAXHKCV-IQIBNGDESA-N |
| XLogP | 6.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|