C24H23NO3 — CID 67287385
methyl 2-[4-[3-(1-naphthalen-1-ylethylamino)prop-1-ynyl]phenoxy]acetate (PubChem CID 67287385) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is methyl 2-[4-[3-(1-naphthalen-1-ylethylamino)prop-1-ynyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[3-(1-naphthalen-1-ylethylamino)prop-1-ynyl]phenoxy]acetate |
|---|---|
| PubChem CID | 67287385 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | methyl 2-[4-[3-(1-naphthalen-1-ylethylamino)prop-1-ynyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C#CCNC(C)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H23NO3/c1-18(22-11-5-9-20-8-3-4-10-23(20)22)25-16-6-7-19-12-14-21(15-13-19)28-17-24(26)27-2/h3-5,8-15,18,25H,16-17H2,1-2H3 |
| InChIKey | ONOADGBCTFMLSB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|