C23H21NO3 — CID 67288005
2-hydroxy-3-methyl-5-[3-(1-naphthalen-1-ylethylamino)prop-1-ynyl]benzoic acid (PubChem CID 67288005) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-hydroxy-3-methyl-5-[3-(1-naphthalen-1-ylethylamino)prop-1-ynyl]benzoic acid.
| Compound Name | 2-hydroxy-3-methyl-5-[3-(1-naphthalen-1-ylethylamino)prop-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 67288005 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-hydroxy-3-methyl-5-[3-(1-naphthalen-1-ylethylamino)prop-1-ynyl]benzoic acid |
| SMILES | Cc1cc(C#CCNC(C)c2cccc3ccccc23)cc(C(=O)O)c1O |
| InChI | InChI=1S/C23H21NO3/c1-15-13-17(14-21(22(15)25)23(26)27)7-6-12-24-16(2)19-11-5-9-18-8-3-4-10-20(18)19/h3-5,8-11,13-14,16,24-25H,12H2,1-2H3,(H,26,27) |
| InChIKey | WTBKBRMLHPUZBW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|