C16H23NS — CID 63833767
1-(1-benzothiophen-3-yl)-3,4,4-trimethylpentan-1-amine (PubChem CID 63833767) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-3,4,4-trimethylpentan-1-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-3,4,4-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 63833767 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-3,4,4-trimethylpentan-1-amine |
| SMILES | CC(CC(N)c1csc2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C16H23NS/c1-11(16(2,3)4)9-14(17)13-10-18-15-8-6-5-7-12(13)15/h5-8,10-11,14H,9,17H2,1-4H3 |
| InChIKey | HCDLTSONBSNVPT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |