C12H12F3NS — CID 171224591
(1S)-1-(1-benzothiophen-3-yl)-4,4,4-trifluorobutan-1-amine (PubChem CID 171224591) has the molecular formula C12H12F3NS and a molecular weight of 259.30 g/mol. Its IUPAC name is (1S)-1-(1-benzothiophen-3-yl)-4,4,4-trifluorobutan-1-amine.
| Compound Name | (1S)-1-(1-benzothiophen-3-yl)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 171224591 |
| Molecular Formula | C12H12F3NS |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (1S)-1-(1-benzothiophen-3-yl)-4,4,4-trifluorobutan-1-amine |
| SMILES | N[C@@H](CCC(F)(F)F)c1csc2ccccc12 |
| InChI | InChI=1S/C12H12F3NS/c13-12(14,15)6-5-10(16)9-7-17-11-4-2-1-3-8(9)11/h1-4,7,10H,5-6,16H2/t10-/m0/s1 |
| InChIKey | JKUSLVZBQFPAHA-JTQLQIEISA-N |
| XLogP | 4.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |