C10H7F3OS — CID 71757522
(1R)-1-(1-benzothiophen-3-yl)-2,2,2-trifluoroethanol (PubChem CID 71757522) has the molecular formula C10H7F3OS and a molecular weight of 232.23 g/mol. Its IUPAC name is (1R)-1-(1-benzothiophen-3-yl)-2,2,2-trifluoroethanol.
| Compound Name | (1R)-1-(1-benzothiophen-3-yl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 71757522 |
| Molecular Formula | C10H7F3OS |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | (1R)-1-(1-benzothiophen-3-yl)-2,2,2-trifluoroethanol |
| SMILES | O[C@H](c1csc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C10H7F3OS/c11-10(12,13)9(14)7-5-15-8-4-2-1-3-6(7)8/h1-5,9,14H/t9-/m1/s1 |
| InChIKey | WAYSUEKROXOKQO-SECBINFHSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |