C13H15NS — CID 105001023
1-(1-benzothiophen-3-yl)-N-ethylprop-2-en-1-amine (PubChem CID 105001023) has the molecular formula C13H15NS and a molecular weight of 217.34 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N-ethylprop-2-en-1-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-N-ethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105001023 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N-ethylprop-2-en-1-amine |
| SMILES | C=CC(NCC)c1csc2ccccc12 |
| InChI | InChI=1S/C13H15NS/c1-3-12(14-4-2)11-9-15-13-8-6-5-7-10(11)13/h3,5-9,12,14H,1,4H2,2H3 |
| InChIKey | FGJCLNRMHVYNCN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|