C29H31Cl — CID 167268379
3-(3-chlorophenyl)-6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluorene (PubChem CID 167268379) has the molecular formula C29H31Cl and a molecular weight of 415.02 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluorene.
| Compound Name | 3-(3-chlorophenyl)-6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluorene |
|---|---|
| PubChem CID | 167268379 |
| Molecular Formula | C29H31Cl |
| Molecular Weight | 415.02 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 3-(3-chlorophenyl)-6,6,9,9,11,11-hexamethyl-7,8-dihydrobenzo[b]fluorene |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)-c1cc(-c2cccc(Cl)c2)ccc1C3(C)C |
| InChI | InChI=1S/C29H31Cl/c1-27(2)12-13-28(3,4)26-17-24-22(16-25(26)27)21-15-19(10-11-23(21)29(24,5)6)18-8-7-9-20(30)14-18/h7-11,14-17H,12-13H2,1-6H3 |
| InChIKey | LJPYYLQWRMSFQF-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.02 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |