C31H30 — CID 171740128
3,6-bis(3,5-dimethylphenyl)-9,9-dimethylfluorene (PubChem CID 171740128) has the molecular formula C31H30 and a molecular weight of 402.58 g/mol. Its IUPAC name is 3,6-bis(3,5-dimethylphenyl)-9,9-dimethylfluorene.
| Compound Name | 3,6-bis(3,5-dimethylphenyl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 171740128 |
| Molecular Formula | C31H30 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 3,6-bis(3,5-dimethylphenyl)-9,9-dimethylfluorene |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)-c2cc(-c4cc(C)cc(C)c4)ccc2C3(C)C)c1 |
| InChI | InChI=1S/C31H30/c1-19-11-20(2)14-25(13-19)23-7-9-29-27(17-23)28-18-24(8-10-30(28)31(29,5)6)26-15-21(3)12-22(4)16-26/h7-18H,1-6H3 |
| InChIKey | AHBQROTYZDJDEX-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |