C44H44N2 — CID 67965995
2-[6-(3,5-ditert-butylphenyl)-9,9-dimethylfluoren-3-yl]-7-methylphenanthrene-9,10-diimine (PubChem CID 67965995) has the molecular formula C44H44N2 and a molecular weight of 600.85 g/mol. Its IUPAC name is 2-[6-(3,5-ditert-butylphenyl)-9,9-dimethylfluoren-3-yl]-7-methylphenanthrene-9,10-diimine.
| Compound Name | 2-[6-(3,5-ditert-butylphenyl)-9,9-dimethylfluoren-3-yl]-7-methylphenanthrene-9,10-diimine |
|---|---|
| PubChem CID | 67965995 |
| Molecular Formula | C44H44N2 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.35 |
| IUPAC Name | 2-[6-(3,5-ditert-butylphenyl)-9,9-dimethylfluoren-3-yl]-7-methylphenanthrene-9,10-diimine |
| SMILES | [H]/N=C1C(=N\[H])\c2cc(C)ccc2-c2ccc(-c3ccc4c(c3)-c3cc(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)ccc3C4(C)C)cc2\1 |
| InChI | InChI=1S/C44H44N2/c1-25-10-14-32-33-15-11-26(23-37(33)41(46)40(45)36(32)18-25)27-12-16-38-34(21-27)35-22-28(13-17-39(35)44(38,8)9)29-19-30(42(2,3)4)24-31(20-29)43(5,6)7/h10-24,45-46H,1-9H3/b45-40+,46-41- |
| InChIKey | ASSTZAAJRSJIDO-XNASOXDDSA-N |
| XLogP | 11.65 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|