C24H25N — CID 23593227
N,6,9,9-tetramethyl-N-(4-methylphenyl)fluoren-3-amine (PubChem CID 23593227) has the molecular formula C24H25N and a molecular weight of 327.47 g/mol. Its IUPAC name is N,6,9,9-tetramethyl-N-(4-methylphenyl)fluoren-3-amine.
| Compound Name | N,6,9,9-tetramethyl-N-(4-methylphenyl)fluoren-3-amine |
|---|---|
| PubChem CID | 23593227 |
| Molecular Formula | C24H25N |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | N,6,9,9-tetramethyl-N-(4-methylphenyl)fluoren-3-amine |
| SMILES | Cc1ccc(N(C)c2ccc3c(c2)-c2cc(C)ccc2C3(C)C)cc1 |
| InChI | InChI=1S/C24H25N/c1-16-6-9-18(10-7-16)25(5)19-11-13-23-21(15-19)20-14-17(2)8-12-22(20)24(23,3)4/h6-15H,1-5H3 |
| InChIKey | BSWYXKRDUDZLKQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |