C46H43FN2 — CID 23593087
2-N-(2,4-dimethylphenyl)-7-N-(4-fluorophenyl)-7-N,9,9-trimethyl-2-N-(7,9,9-trimethylfluoren-2-yl)fluorene-2,7-diamine (PubChem CID 23593087) has the molecular formula C46H43FN2 and a molecular weight of 642.86 g/mol. Its IUPAC name is 2-N-(2,4-dimethylphenyl)-7-N-(4-fluorophenyl)-7-N,9,9-trimethyl-2-N-(7,9,9-trimethylfluoren-2-yl)fluorene-2,7-diamine.
| Compound Name | 2-N-(2,4-dimethylphenyl)-7-N-(4-fluorophenyl)-7-N,9,9-trimethyl-2-N-(7,9,9-trimethylfluoren-2-yl)fluorene-2,7-diamine |
|---|---|
| PubChem CID | 23593087 |
| Molecular Formula | C46H43FN2 |
| Molecular Weight | 642.86 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | 2-N-(2,4-dimethylphenyl)-7-N-(4-fluorophenyl)-7-N,9,9-trimethyl-2-N-(7,9,9-trimethylfluoren-2-yl)fluorene-2,7-diamine |
| SMILES | Cc1ccc(N(c2ccc3c(c2)C(C)(C)c2cc(C)ccc2-3)c2ccc3c(c2)C(C)(C)c2cc(N(C)c4ccc(F)cc4)ccc2-3)c(C)c1 |
| InChI | InChI=1S/C46H43FN2/c1-28-10-22-44(30(3)23-28)49(34-16-20-38-36-18-9-29(2)24-40(36)45(4,5)42(38)26-34)35-17-21-39-37-19-15-33(25-41(37)46(6,7)43(39)27-35)48(8)32-13-11-31(47)12-14-32/h9-27H,1-8H3 |
| InChIKey | JOOPOMZEXSMWKJ-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.86 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |