C24H22F3N — CID 23593235
N,7,9,9-tetramethyl-N-[3-(trifluoromethyl)phenyl]fluoren-2-amine (PubChem CID 23593235) has the molecular formula C24H22F3N and a molecular weight of 381.44 g/mol. Its IUPAC name is N,7,9,9-tetramethyl-N-[3-(trifluoromethyl)phenyl]fluoren-2-amine.
| Compound Name | N,7,9,9-tetramethyl-N-[3-(trifluoromethyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 23593235 |
| Molecular Formula | C24H22F3N |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N,7,9,9-tetramethyl-N-[3-(trifluoromethyl)phenyl]fluoren-2-amine |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(N(C)c3cccc(C(F)(F)F)c3)ccc1-2 |
| InChI | InChI=1S/C24H22F3N/c1-15-8-10-19-20-11-9-18(14-22(20)23(2,3)21(19)12-15)28(4)17-7-5-6-16(13-17)24(25,26)27/h5-14H,1-4H3 |
| InChIKey | FPWSBFHGXPJKRR-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |