C34H29N — CID 166028533
N,9,9-trimethyl-N-[3-(3-phenylphenyl)phenyl]fluoren-2-amine (PubChem CID 166028533) has the molecular formula C34H29N and a molecular weight of 451.61 g/mol. Its IUPAC name is N,9,9-trimethyl-N-[3-(3-phenylphenyl)phenyl]fluoren-2-amine.
| Compound Name | N,9,9-trimethyl-N-[3-(3-phenylphenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 166028533 |
| Molecular Formula | C34H29N |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N,9,9-trimethyl-N-[3-(3-phenylphenyl)phenyl]fluoren-2-amine |
| SMILES | CN(c1cccc(-c2cccc(-c3ccccc3)c2)c1)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C34H29N/c1-34(2)32-18-8-7-17-30(32)31-20-19-29(23-33(31)34)35(3)28-16-10-15-27(22-28)26-14-9-13-25(21-26)24-11-5-4-6-12-24/h4-23H,1-3H3 |
| InChIKey | FBOUXBPSPINUJF-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |