C28H26N2S — CID 177242761
[2-(9,9-dimethylfluoren-2-yl)-2-(3-phenylphenyl)hydrazinyl]methanethiol (PubChem CID 177242761) has the molecular formula C28H26N2S and a molecular weight of 422.60 g/mol. Its IUPAC name is [2-(9,9-dimethylfluoren-2-yl)-2-(3-phenylphenyl)hydrazinyl]methanethiol.
| Compound Name | [2-(9,9-dimethylfluoren-2-yl)-2-(3-phenylphenyl)hydrazinyl]methanethiol |
|---|---|
| PubChem CID | 177242761 |
| Molecular Formula | C28H26N2S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [2-(9,9-dimethylfluoren-2-yl)-2-(3-phenylphenyl)hydrazinyl]methanethiol |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(NCS)c3cccc(-c4ccccc4)c3)cc21 |
| InChI | InChI=1S/C28H26N2S/c1-28(2)26-14-7-6-13-24(26)25-16-15-23(18-27(25)28)30(29-19-31)22-12-8-11-21(17-22)20-9-4-3-5-10-20/h3-18,29,31H,19H2,1-2H3 |
| InChIKey | HWFVLNPNMMZZTR-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|