C21H18FN — CID 23597859
N-(4-fluorophenyl)-N,7-dimethyl-9H-fluoren-2-amine (PubChem CID 23597859) has the molecular formula C21H18FN and a molecular weight of 303.38 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N,7-dimethyl-9H-fluoren-2-amine.
| Compound Name | N-(4-fluorophenyl)-N,7-dimethyl-9H-fluoren-2-amine |
|---|---|
| PubChem CID | 23597859 |
| Molecular Formula | C21H18FN |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-(4-fluorophenyl)-N,7-dimethyl-9H-fluoren-2-amine |
| SMILES | Cc1ccc2c(c1)Cc1cc(N(C)c3ccc(F)cc3)ccc1-2 |
| InChI | InChI=1S/C21H18FN/c1-14-3-9-20-15(11-14)12-16-13-19(8-10-21(16)20)23(2)18-6-4-17(22)5-7-18/h3-11,13H,12H2,1-2H3 |
| InChIKey | BLQYAWUMFUPYRX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |