C32H35N — CID 143983290
N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-N,3,5-trimethylaniline;ethane (PubChem CID 143983290) has the molecular formula C32H35N and a molecular weight of 433.64 g/mol. Its IUPAC name is N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-N,3,5-trimethylaniline;ethane.
| Compound Name | N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-N,3,5-trimethylaniline;ethane |
|---|---|
| PubChem CID | 143983290 |
| Molecular Formula | C32H35N |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-N,3,5-trimethylaniline;ethane |
| SMILES | CC.Cc1cc(C)cc(N(C)c2ccc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)c1 |
| InChI | InChI=1S/C30H29N.C2H6/c1-20-16-21(2)18-25(17-20)31(5)24-13-10-22(11-14-24)23-12-15-27-26-8-6-7-9-28(26)30(3,4)29(27)19-23;1-2/h6-19H,1-5H3;1-2H3 |
| InChIKey | LNAMFUBSRCRXFB-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |