C87H88 — CID 160842443
2,7-bis(3,5-dimethylphenyl)-9,9-dimethylfluorene;1,3,6,8-tetrakis(4-tert-butylphenyl)pyrene (PubChem CID 160842443) has the molecular formula C87H88 and a molecular weight of 1133.66 g/mol. Its IUPAC name is 2,7-bis(3,5-dimethylphenyl)-9,9-dimethylfluorene;1,3,6,8-tetrakis(4-tert-butylphenyl)pyrene.
| Compound Name | 2,7-bis(3,5-dimethylphenyl)-9,9-dimethylfluorene;1,3,6,8-tetrakis(4-tert-butylphenyl)pyrene |
|---|---|
| PubChem CID | 160842443 |
| Molecular Formula | C87H88 |
| Molecular Weight | 1133.66 g/mol |
| Exact Mass | 1132.69 |
| IUPAC Name | 2,7-bis(3,5-dimethylphenyl)-9,9-dimethylfluorene;1,3,6,8-tetrakis(4-tert-butylphenyl)pyrene |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)c3ccc4c(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c5ccc2c3c54)cc1.Cc1cc(C)cc(-c2ccc3c(c2)C(C)(C)c2cc(-c4cc(C)cc(C)c4)ccc2-3)c1 |
| InChI | InChI=1S/C56H58.C31H30/c1-53(2,3)39-21-13-35(14-22-39)47-33-48(36-15-23-40(24-16-36)54(4,5)6)44-31-32-46-50(38-19-27-42(28-20-38)56(10,11)12)34-49(45-30-29-43(47)51(44)52(45)46)37-17-25-41(26-18-37)55(7,8)9;1-19-11-20(2)14-25(13-19)23-7-9-27-28-10-8-24(26-15-21(3)12-22(4)16-26)18-30(28)31(5,6)29(27)17-23/h13-34H,1-12H3;7-18H,1-6H3 |
| InChIKey | SIEYNNRPMUPUCV-UHFFFAOYSA-N |
| XLogP | 25.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1133.66 |
| LogP ≤ 5 | 25.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|