C29H33B — CID 142567911
1-[3-(9,9-dimethylfluoren-3-yl)phenyl]-3,3,4,4-tetramethylborolane (PubChem CID 142567911) has the molecular formula C29H33B and a molecular weight of 392.40 g/mol. Its IUPAC name is 1-[3-(9,9-dimethylfluoren-3-yl)phenyl]-3,3,4,4-tetramethylborolane.
| Compound Name | 1-[3-(9,9-dimethylfluoren-3-yl)phenyl]-3,3,4,4-tetramethylborolane |
|---|---|
| PubChem CID | 142567911 |
| Molecular Formula | C29H33B |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 1-[3-(9,9-dimethylfluoren-3-yl)phenyl]-3,3,4,4-tetramethylborolane |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3cccc(B4CC(C)(C)C(C)(C)C4)c3)ccc21 |
| InChI | InChI=1S/C29H33B/c1-27(2)18-30(19-28(27,3)4)22-11-9-10-20(16-22)21-14-15-26-24(17-21)23-12-7-8-13-25(23)29(26,5)6/h7-17H,18-19H2,1-6H3 |
| InChIKey | DDAFXHBAFXTTSD-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|