C16H16ClN — CID 141028677
5-(3-chlorophenyl)-3,3-dimethyl-1,2-dihydroindole (PubChem CID 141028677) has the molecular formula C16H16ClN and a molecular weight of 257.76 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3,3-dimethyl-1,2-dihydroindole.
| Compound Name | 5-(3-chlorophenyl)-3,3-dimethyl-1,2-dihydroindole |
|---|---|
| PubChem CID | 141028677 |
| Molecular Formula | C16H16ClN |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5-(3-chlorophenyl)-3,3-dimethyl-1,2-dihydroindole |
| SMILES | CC1(C)CNc2ccc(-c3cccc(Cl)c3)cc21 |
| InChI | InChI=1S/C16H16ClN/c1-16(2)10-18-15-7-6-12(9-14(15)16)11-4-3-5-13(17)8-11/h3-9,18H,10H2,1-2H3 |
| InChIKey | RYBYCNIBLRPVBM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |