C20H25BO2 — CID 170612242
[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]boronic acid (PubChem CID 170612242) has the molecular formula C20H25BO2 and a molecular weight of 308.23 g/mol. Its IUPAC name is [4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]boronic acid.
| Compound Name | [4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 170612242 |
| Molecular Formula | C20H25BO2 |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | [4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]boronic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3ccc(B(O)O)cc3)ccc21 |
| InChI | InChI=1S/C20H25BO2/c1-19(2)11-12-20(3,4)18-13-15(7-10-17(18)19)14-5-8-16(9-6-14)21(22)23/h5-10,13,22-23H,11-12H2,1-4H3 |
| InChIKey | YYFHJYQLDXBVNX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|