C64H49N5 — CID 167268675
12-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-11-[4-[4-(1,1,3,3-tetramethyl-2H-inden-5-yl)phenyl]phenyl]indolo[2,3-a]carbazole (PubChem CID 167268675) has the molecular formula C64H49N5 and a molecular weight of 888.13 g/mol. Its IUPAC name is 12-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-11-[4-[4-(1,1,3,3-tetramethyl-2H-inden-5-yl)phenyl]phenyl]indolo[2,3-a]carbazole.
| Compound Name | 12-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-11-[4-[4-(1,1,3,3-tetramethyl-2H-inden-5-yl)phenyl]phenyl]indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 167268675 |
| Molecular Formula | C64H49N5 |
| Molecular Weight | 888.13 g/mol |
| Exact Mass | 887.40 |
| IUPAC Name | 12-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-11-[4-[4-(1,1,3,3-tetramethyl-2H-inden-5-yl)phenyl]phenyl]indolo[2,3-a]carbazole |
| SMILES | CC1(C)CC(C)(C)c2cc(-c3ccc(-c4ccc(-n5c6ccccc6c6ccc7c8ccccc8n(-c8nc(-c9ccccc9)nc(-c9cccc(-c%10ccccc%10)c9)n8)c7c65)cc4)cc3)ccc21 |
| InChI | InChI=1S/C64H49N5/c1-63(2)40-64(3,4)55-39-47(32-37-54(55)63)44-28-26-42(27-29-44)43-30-33-49(34-31-43)68-56-24-13-11-22-50(56)52-35-36-53-51-23-12-14-25-57(51)69(59(53)58(52)68)62-66-60(45-18-9-6-10-19-45)65-61(67-62)48-21-15-20-46(38-48)41-16-7-5-8-17-41/h5-39H,40H2,1-4H3 |
| InChIKey | AHMVIOGOFQZHKX-UHFFFAOYSA-N |
| XLogP | 16.36 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.13 |
| LogP ≤ 5 | 16.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |