C59H47N5 — CID 167268838
11-[3-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)phenyl]-12-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole (PubChem CID 167268838) has the molecular formula C59H47N5 and a molecular weight of 826.06 g/mol. Its IUPAC name is 11-[3-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)phenyl]-12-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole.
| Compound Name | 11-[3-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)phenyl]-12-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 167268838 |
| Molecular Formula | C59H47N5 |
| Molecular Weight | 826.06 g/mol |
| Exact Mass | 825.38 |
| IUPAC Name | 11-[3-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)phenyl]-12-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole |
| SMILES | CC1C(C)(C)c2ccc(-c3cccc(-n4c5ccccc5c5ccc6c7ccccc7n(-c7nc(-c8ccccc8)nc(-c8cccc(-c9ccccc9)c8)n7)c6c54)c3)cc2C1(C)C |
| InChI | InChI=1S/C59H47N5/c1-37-58(2,3)49-33-30-42(36-50(49)59(37,4)5)41-23-17-25-44(35-41)63-51-28-14-12-26-45(51)47-31-32-48-46-27-13-15-29-52(46)64(54(48)53(47)63)57-61-55(39-20-10-7-11-21-39)60-56(62-57)43-24-16-22-40(34-43)38-18-8-6-9-19-38/h6-37H,1-5H3 |
| InChIKey | OAJWGRVKFOWVCZ-UHFFFAOYSA-N |
| XLogP | 14.94 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.06 |
| LogP ≤ 5 | 14.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |