C44H31N5O — CID 172507243
5-[4-[10-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]phenyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 172507243) has the molecular formula C44H31N5O and a molecular weight of 645.77 g/mol. Its IUPAC name is 5-[4-[10-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]phenyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[4-[10-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]phenyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 172507243 |
| Molecular Formula | C44H31N5O |
| Molecular Weight | 645.77 g/mol |
| Exact Mass | 645.25 |
| IUPAC Name | 5-[4-[10-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]phenyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(-c3ccc(-c4c5ccccc5c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c5ccccc45)cc3)ccc21 |
| InChI | InChI=1S/C44H31N5O/c1-48-37-26-25-32(27-38(37)49(2)44(48)50)28-21-23-29(24-22-28)39-33-17-9-11-19-35(33)40(36-20-12-10-18-34(36)39)43-46-41(30-13-5-3-6-14-30)45-42(47-43)31-15-7-4-8-16-31/h3-27H,1-2H3 |
| InChIKey | KZYZWJXYLXUJDI-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.77 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|