C48H33N5O — CID 172507648
1,3-dimethyl-5-[4-[4-phenyl-6-(4-triphenylen-2-ylphenyl)-1,3,5-triazin-2-yl]phenyl]benzimidazol-2-one (PubChem CID 172507648) has the molecular formula C48H33N5O and a molecular weight of 695.83 g/mol. Its IUPAC name is 1,3-dimethyl-5-[4-[4-phenyl-6-(4-triphenylen-2-ylphenyl)-1,3,5-triazin-2-yl]phenyl]benzimidazol-2-one.
| Compound Name | 1,3-dimethyl-5-[4-[4-phenyl-6-(4-triphenylen-2-ylphenyl)-1,3,5-triazin-2-yl]phenyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 172507648 |
| Molecular Formula | C48H33N5O |
| Molecular Weight | 695.83 g/mol |
| Exact Mass | 695.27 |
| IUPAC Name | 1,3-dimethyl-5-[4-[4-phenyl-6-(4-triphenylen-2-ylphenyl)-1,3,5-triazin-2-yl]phenyl]benzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccc7c8ccccc8c8ccccc8c7c6)cc5)n4)cc3)ccc21 |
| InChI | InChI=1S/C48H33N5O/c1-52-43-27-25-36(29-44(43)53(2)48(52)54)31-18-22-34(23-19-31)47-50-45(32-10-4-3-5-11-32)49-46(51-47)33-20-16-30(17-21-33)35-24-26-41-39-14-7-6-12-37(39)38-13-8-9-15-40(38)42(41)28-35/h3-29H,1-2H3 |
| InChIKey | UOWYJPWPUJLVSY-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.83 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|