C43H30N4O — CID 172507310
5-[3-(6-chrysen-2-yl-2-phenylpyrimidin-4-yl)phenyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 172507310) has the molecular formula C43H30N4O and a molecular weight of 618.74 g/mol. Its IUPAC name is 5-[3-(6-chrysen-2-yl-2-phenylpyrimidin-4-yl)phenyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[3-(6-chrysen-2-yl-2-phenylpyrimidin-4-yl)phenyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 172507310 |
| Molecular Formula | C43H30N4O |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | 5-[3-(6-chrysen-2-yl-2-phenylpyrimidin-4-yl)phenyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(-c3cccc(-c4cc(-c5ccc6c(ccc7c8ccccc8ccc67)c5)nc(-c5ccccc5)n4)c3)ccc21 |
| InChI | InChI=1S/C43H30N4O/c1-46-40-22-18-30(25-41(40)47(2)43(46)48)29-12-8-13-32(23-29)38-26-39(45-42(44-38)28-10-4-3-5-11-28)33-17-19-35-31(24-33)16-21-36-34-14-7-6-9-27(34)15-20-37(35)36/h3-26H,1-2H3 |
| InChIKey | QELTXHKXEHFVTH-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|