C38H27N5O — CID 172507615
1,3-dimethyl-5-[3-(4-phenanthren-4-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]benzimidazol-2-one (PubChem CID 172507615) has the molecular formula C38H27N5O and a molecular weight of 569.67 g/mol. Its IUPAC name is 1,3-dimethyl-5-[3-(4-phenanthren-4-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]benzimidazol-2-one.
| Compound Name | 1,3-dimethyl-5-[3-(4-phenanthren-4-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 172507615 |
| Molecular Formula | C38H27N5O |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 1,3-dimethyl-5-[3-(4-phenanthren-4-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]benzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5cccc6ccc7ccccc7c56)n4)c3)ccc21 |
| InChI | InChI=1S/C38H27N5O/c1-42-32-21-20-28(23-33(32)43(2)38(42)44)27-14-8-15-29(22-27)36-39-35(26-11-4-3-5-12-26)40-37(41-36)31-17-9-13-25-19-18-24-10-6-7-16-30(24)34(25)31/h3-23H,1-2H3 |
| InChIKey | XXFQDTAFUOZSQL-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|