C51H36N4O — CID 172507555
5-[4-[10-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]anthracen-9-yl]phenyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 172507555) has the molecular formula C51H36N4O and a molecular weight of 720.88 g/mol. Its IUPAC name is 5-[4-[10-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]anthracen-9-yl]phenyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[4-[10-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]anthracen-9-yl]phenyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 172507555 |
| Molecular Formula | C51H36N4O |
| Molecular Weight | 720.88 g/mol |
| Exact Mass | 720.29 |
| IUPAC Name | 5-[4-[10-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]anthracen-9-yl]phenyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(-c3ccc(-c4c5ccccc5c(-c5ccc(-c6cc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)c5ccccc45)cc3)ccc21 |
| InChI | InChI=1S/C51H36N4O/c1-54-46-30-29-39(31-47(46)55(2)51(54)56)33-21-25-36(26-22-33)48-40-17-9-11-19-42(40)49(43-20-12-10-18-41(43)48)37-27-23-35(24-28-37)45-32-44(34-13-5-3-6-14-34)52-50(53-45)38-15-7-4-8-16-38/h3-32H,1-2H3 |
| InChIKey | VFLWOHMIXPETRP-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.88 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|