C49H41N5 — CID 171749073
8-[6-[4-phenyl-6-[3-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]-3-pyridinyl]quinoline (PubChem CID 171749073) has the molecular formula C49H41N5 and a molecular weight of 699.90 g/mol. Its IUPAC name is 8-[6-[4-phenyl-6-[3-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]-3-pyridinyl]quinoline.
| Compound Name | 8-[6-[4-phenyl-6-[3-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]-3-pyridinyl]quinoline |
|---|---|
| PubChem CID | 171749073 |
| Molecular Formula | C49H41N5 |
| Molecular Weight | 699.90 g/mol |
| Exact Mass | 699.34 |
| IUPAC Name | 8-[6-[4-phenyl-6-[3-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]-3-pyridinyl]quinoline |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3ccccc3-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6cccc7cccnc67)cn5)n4)c3)ccc21 |
| InChI | InChI=1S/C49H41N5/c1-48(2)26-27-49(3,4)42-30-35(22-24-41(42)48)39-20-9-8-19-38(39)34-16-10-17-36(29-34)46-52-45(33-13-6-5-7-14-33)53-47(54-46)43-25-23-37(31-51-43)40-21-11-15-32-18-12-28-50-44(32)40/h5-25,28-31H,26-27H2,1-4H3 |
| InChIKey | RHUCMNHSQDGLGO-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.90 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |