C26H26Si — CID 140852226
triphenyl-(2,3,5-trimethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 140852226) has the molecular formula C26H26Si and a molecular weight of 366.58 g/mol. Its IUPAC name is triphenyl-(2,3,5-trimethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | triphenyl-(2,3,5-trimethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 140852226 |
| Molecular Formula | C26H26Si |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | triphenyl-(2,3,5-trimethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC(C)=C(C)C1[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26Si/c1-20-19-21(2)26(22(20)3)27(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-19,26H,1-3H3 |
| InChIKey | IGAOOQYTHISQSP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|