C18H28Si — CID 100952067
dimethyl-bis[(1S)-2,3,5-trimethylcyclopenta-2,4-dien-1-yl]silane (PubChem CID 100952067) has the molecular formula C18H28Si and a molecular weight of 272.51 g/mol. Its IUPAC name is dimethyl-bis[(1S)-2,3,5-trimethylcyclopenta-2,4-dien-1-yl]silane.
| Compound Name | dimethyl-bis[(1S)-2,3,5-trimethylcyclopenta-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 100952067 |
| Molecular Formula | C18H28Si |
| Molecular Weight | 272.51 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | dimethyl-bis[(1S)-2,3,5-trimethylcyclopenta-2,4-dien-1-yl]silane |
| SMILES | CC1=CC(C)=C(C)[C@H]1[Si](C)(C)[C@H]1C(C)=CC(C)=C1C |
| InChI | InChI=1S/C18H28Si/c1-11-9-13(3)17(15(11)5)19(7,8)18-14(4)10-12(2)16(18)6/h9-10,17-18H,1-8H3/t17-,18-/m0/s1 |
| InChIKey | ODITXPNOWGXPDZ-ROUUACIJSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.51 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|