C28H32Si — CID 10894569
bis(2,5-dimethyl-3-phenylcyclopenta-2,4-dien-1-yl)-dimethylsilane (PubChem CID 10894569) has the molecular formula C28H32Si and a molecular weight of 396.65 g/mol. Its IUPAC name is bis(2,5-dimethyl-3-phenylcyclopenta-2,4-dien-1-yl)-dimethylsilane.
| Compound Name | bis(2,5-dimethyl-3-phenylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 10894569 |
| Molecular Formula | C28H32Si |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | bis(2,5-dimethyl-3-phenylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
| SMILES | CC1=CC(c2ccccc2)=C(C)C1[Si](C)(C)C1C(C)=CC(c2ccccc2)=C1C |
| InChI | InChI=1S/C28H32Si/c1-19-17-25(23-13-9-7-10-14-23)21(3)27(19)29(5,6)28-20(2)18-26(22(28)4)24-15-11-8-12-16-24/h7-18,27-28H,1-6H3 |
| InChIKey | VCORBQZGGXNSBA-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|