About (4-methylphenyl)-diphenyl-triphenylsilylsilane
(4-methylphenyl)-diphenyl-triphenylsilylsilane (PubChem CID 4518674) has the molecular formula C37H32Si2
and a molecular weight of 532.84 g/mol. Its IUPAC name is (4-methylphenyl)-diphenyl-triphenylsilylsilane.
Molecular Properties
| Compound Name | (4-methylphenyl)-diphenyl-triphenylsilylsilane |
| PubChem CID | 4518674 |
| Molecular Formula | C37H32Si2 |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (4-methylphenyl)-diphenyl-triphenylsilylsilane |
| SMILES | Cc1ccc([Si](c2ccccc2)(c2ccccc2)[Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H32Si2/c1-31-27-29-37(30-28-31)39(35-23-13-5-14-24-35,36-25-15-6-16-26-36)38(32-17-7-2-8-18-32,33-19-9-3-10-20-33)34-21-11-4-12-22-34/h2-30H,1H3 |
| InChIKey | JLILIIPSKZCVRU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)-diphenyl-triphenylsilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)-diphenyl-triphenylsilylsilane?
The IUPAC name of (4-methylphenyl)-diphenyl-triphenylsilylsilane (CID 4518674) is (4-methylphenyl)-diphenyl-triphenylsilylsilane.
What is the SMILES notation for (4-methylphenyl)-diphenyl-triphenylsilylsilane?
The canonical SMILES for (4-methylphenyl)-diphenyl-triphenylsilylsilane is Cc1ccc([Si](c2ccccc2)(c2ccccc2)[Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (4-methylphenyl)-diphenyl-triphenylsilylsilane?
The InChIKey is JLILIIPSKZCVRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H32Si2/c1-31-27-29-37(30-28-31)39(35-23-13-5-14-24-35,36-25-15-6-16-26-36)38(32-17-7-2-8-18-32,33-19-9-3-10-20-33)34-21-11-4-12-22-34/h2-30H,1H3.
What are the key properties of (4-methylphenyl)-diphenyl-triphenylsilylsilane?
(4-methylphenyl)-diphenyl-triphenylsilylsilane has a molecular weight of 532.84 g/mol, XLogP of 4.71, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)-diphenyl-triphenylsilylsilane is sourced from PubChem (CID 4518674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).