About radon;toluene;1,4-xylene
radon;toluene;1,4-xylene (PubChem CID 174747246) has the molecular formula C15H18Rn
and a molecular weight of 420.31 g/mol. Its IUPAC name is radon;toluene;1,4-xylene.
Molecular Properties
| Compound Name | radon;toluene;1,4-xylene |
| PubChem CID | 174747246 |
| Molecular Formula | C15H18Rn |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | radon;toluene;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.Cc1ccccc1.[Rn] |
| InChI | InChI=1S/C8H10.C7H8.Rn/c1-7-3-5-8(2)6-4-7;1-7-5-3-2-4-6-7;/h3-6H,1-2H3;2-6H,1H3; |
| InChIKey | ZBVAVJIBMHYMNR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze radon;toluene;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of radon;toluene;1,4-xylene?
The IUPAC name of radon;toluene;1,4-xylene (CID 174747246) is radon;toluene;1,4-xylene.
What is the SMILES notation for radon;toluene;1,4-xylene?
The canonical SMILES for radon;toluene;1,4-xylene is Cc1ccc(C)cc1.Cc1ccccc1.[Rn].
What is the InChIKey of radon;toluene;1,4-xylene?
The InChIKey is ZBVAVJIBMHYMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C7H8.Rn/c1-7-3-5-8(2)6-4-7;1-7-5-3-2-4-6-7;/h3-6H,1-2H3;2-6H,1H3;.
What are the key properties of radon;toluene;1,4-xylene?
radon;toluene;1,4-xylene has a molecular weight of 420.31 g/mol, XLogP of 4.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for radon;toluene;1,4-xylene is sourced from PubChem (CID 174747246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).