C48H42N2Si — CID 168786471
dimethyl-bis[2-methyl-4-(9-methylcarbazol-3-yl)-1H-inden-1-yl]silane (PubChem CID 168786471) has the molecular formula C48H42N2Si and a molecular weight of 674.96 g/mol. Its IUPAC name is dimethyl-bis[2-methyl-4-(9-methylcarbazol-3-yl)-1H-inden-1-yl]silane.
| Compound Name | dimethyl-bis[2-methyl-4-(9-methylcarbazol-3-yl)-1H-inden-1-yl]silane |
|---|---|
| PubChem CID | 168786471 |
| Molecular Formula | C48H42N2Si |
| Molecular Weight | 674.96 g/mol |
| Exact Mass | 674.31 |
| IUPAC Name | dimethyl-bis[2-methyl-4-(9-methylcarbazol-3-yl)-1H-inden-1-yl]silane |
| SMILES | CC1=Cc2c(-c3ccc4c(c3)c3ccccc3n4C)cccc2C1[Si](C)(C)C1C(C)=Cc2c(-c3ccc4c(c3)c3ccccc3n4C)cccc21 |
| InChI | InChI=1S/C48H42N2Si/c1-29-25-39-33(31-21-23-45-41(27-31)35-13-7-9-19-43(35)49(45)3)15-11-17-37(39)47(29)51(5,6)48-30(2)26-40-34(16-12-18-38(40)48)32-22-24-46-42(28-32)36-14-8-10-20-44(36)50(46)4/h7-28,47-48H,1-6H3 |
| InChIKey | UTUZFZUOPFTFKI-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.96 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|