C24H27ClSi2 — CID 163422359
chloro-[dimethyl-(2-methyl-4-naphthalen-1-yl-1H-inden-1-yl)silyl]-dimethylsilane (PubChem CID 163422359) has the molecular formula C24H27ClSi2 and a molecular weight of 407.11 g/mol. Its IUPAC name is chloro-[dimethyl-(2-methyl-4-naphthalen-1-yl-1H-inden-1-yl)silyl]-dimethylsilane.
| Compound Name | chloro-[dimethyl-(2-methyl-4-naphthalen-1-yl-1H-inden-1-yl)silyl]-dimethylsilane |
|---|---|
| PubChem CID | 163422359 |
| Molecular Formula | C24H27ClSi2 |
| Molecular Weight | 407.11 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | chloro-[dimethyl-(2-methyl-4-naphthalen-1-yl-1H-inden-1-yl)silyl]-dimethylsilane |
| SMILES | CC1=Cc2c(-c3cccc4ccccc34)cccc2C1[Si](C)(C)[Si](C)(C)Cl |
| InChI | InChI=1S/C24H27ClSi2/c1-17-16-23-21(20-13-8-11-18-10-6-7-12-19(18)20)14-9-15-22(23)24(17)26(2,3)27(4,5)25/h6-16,24H,1-5H3 |
| InChIKey | AJMVXOKYLILBFK-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.11 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|