C43H48N2OSi — CID 140721281
methyl-bis(5-methyl-10H-indeno[1,2-b]indol-10-yl)-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane (PubChem CID 140721281) has the molecular formula C43H48N2OSi and a molecular weight of 636.96 g/mol. Its IUPAC name is methyl-bis(5-methyl-10H-indeno[1,2-b]indol-10-yl)-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane.
| Compound Name | methyl-bis(5-methyl-10H-indeno[1,2-b]indol-10-yl)-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
|---|---|
| PubChem CID | 140721281 |
| Molecular Formula | C43H48N2OSi |
| Molecular Weight | 636.96 g/mol |
| Exact Mass | 636.35 |
| IUPAC Name | methyl-bis(5-methyl-10H-indeno[1,2-b]indol-10-yl)-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
| SMILES | Cn1c2c(c3ccccc31)C([Si](C)(CCCCCCOC(C)(C)C)C1c3ccccc3-c3c1c1ccccc1n3C)c1ccccc1-2 |
| InChI | InChI=1S/C43H48N2OSi/c1-43(2,3)46-27-17-7-8-18-28-47(6,41-31-21-11-9-19-29(31)39-37(41)33-23-13-15-25-35(33)44(39)4)42-32-22-12-10-20-30(32)40-38(42)34-24-14-16-26-36(34)45(40)5/h9-16,19-26,41-42H,7-8,17-18,27-28H2,1-6H3 |
| InChIKey | ABMRJVJYWJDYGK-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 19.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.96 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|