C26H45NOSi — CID 153475989
N-[(3,4-dimethyl-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]-2-methylpropan-2-amine (PubChem CID 153475989) has the molecular formula C26H45NOSi and a molecular weight of 415.74 g/mol. Its IUPAC name is N-[(3,4-dimethyl-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]-2-methylpropan-2-amine.
| Compound Name | N-[(3,4-dimethyl-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 153475989 |
| Molecular Formula | C26H45NOSi |
| Molecular Weight | 415.74 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | N-[(3,4-dimethyl-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]-2-methylpropan-2-amine |
| SMILES | CC1=CC([Si](C)(CCCCCCOC(C)(C)C)NC(C)(C)C)c2cccc(C)c21 |
| InChI | InChI=1S/C26H45NOSi/c1-20-15-14-16-22-23(19-21(2)24(20)22)29(9,27-25(3,4)5)18-13-11-10-12-17-28-26(6,7)8/h14-16,19,23,27H,10-13,17-18H2,1-9H3 |
| InChIKey | DYVVLSTXNMBNGK-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.74 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|