C25H51NOSSi — CID 164779479
2-methyl-N-[methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-(2,4,5-trimethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-6-yl)silyl]propan-2-amine (PubChem CID 164779479) has the molecular formula C25H51NOSSi and a molecular weight of 441.84 g/mol. Its IUPAC name is 2-methyl-N-[methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-(2,4,5-trimethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-6-yl)silyl]propan-2-amine.
| Compound Name | 2-methyl-N-[methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-(2,4,5-trimethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-6-yl)silyl]propan-2-amine |
|---|---|
| PubChem CID | 164779479 |
| Molecular Formula | C25H51NOSSi |
| Molecular Weight | 441.84 g/mol |
| Exact Mass | 441.35 |
| IUPAC Name | 2-methyl-N-[methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-(2,4,5-trimethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-6-yl)silyl]propan-2-amine |
| SMILES | CC1CC2C(C)C(C)C([Si](C)(CCCCCCOC(C)(C)C)NC(C)(C)C)C2S1 |
| InChI | InChI=1S/C25H51NOSSi/c1-18-17-21-19(2)20(3)23(22(21)28-18)29(10,26-24(4,5)6)16-14-12-11-13-15-27-25(7,8)9/h18-23,26H,11-17H2,1-10H3 |
| InChIKey | VQEIDIYBHJJNHM-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.84 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|