C43H78OSi — CID 140664993
bis(4-cyclohexyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane (PubChem CID 140664993) has the molecular formula C43H78OSi and a molecular weight of 639.18 g/mol. Its IUPAC name is bis(4-cyclohexyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane.
| Compound Name | bis(4-cyclohexyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
|---|---|
| PubChem CID | 140664993 |
| Molecular Formula | C43H78OSi |
| Molecular Weight | 639.18 g/mol |
| Exact Mass | 638.58 |
| IUPAC Name | bis(4-cyclohexyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
| SMILES | CC1CC2C(C3CCCCC3)CCCC2C1[Si](C)(CCCCCCOC(C)(C)C)C1C(C)CC2C(C3CCCCC3)CCCC21 |
| InChI | InChI=1S/C43H78OSi/c1-31-29-39-35(33-19-11-9-12-20-33)23-17-25-37(39)41(31)45(6,28-16-8-7-15-27-44-43(3,4)5)42-32(2)30-40-36(24-18-26-38(40)42)34-21-13-10-14-22-34/h31-42H,7-30H2,1-6H3 |
| InChIKey | BEYPSHOUCNSWPP-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.18 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|