C38H56OSi — CID 123669309
methyl-bis(2-methyl-4-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-[(2-methylpropan-2-yl)oxymethyl]silane (PubChem CID 123669309) has the molecular formula C38H56OSi and a molecular weight of 556.95 g/mol. Its IUPAC name is methyl-bis(2-methyl-4-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-[(2-methylpropan-2-yl)oxymethyl]silane.
| Compound Name | methyl-bis(2-methyl-4-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-[(2-methylpropan-2-yl)oxymethyl]silane |
|---|---|
| PubChem CID | 123669309 |
| Molecular Formula | C38H56OSi |
| Molecular Weight | 556.95 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | methyl-bis(2-methyl-4-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-[(2-methylpropan-2-yl)oxymethyl]silane |
| SMILES | CC1CC2C(c3ccccc3)CCCC2C1[Si](C)(COC(C)(C)C)C1C(C)CC2C(c3ccccc3)CCCC21 |
| InChI | InChI=1S/C38H56OSi/c1-26-23-34-30(28-15-9-7-10-16-28)19-13-21-32(34)36(26)40(6,25-39-38(3,4)5)37-27(2)24-35-31(20-14-22-33(35)37)29-17-11-8-12-18-29/h7-12,15-18,26-27,30-37H,13-14,19-25H2,1-6H3 |
| InChIKey | UEWPTBIXWBAOSD-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.95 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|