C31H48SSi — CID 162298378
[4-(4-tert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(4,5-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane (PubChem CID 162298378) has the molecular formula C31H48SSi and a molecular weight of 480.88 g/mol. Its IUPAC name is [4-(4-tert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(4,5-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane.
| Compound Name | [4-(4-tert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(4,5-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane |
|---|---|
| PubChem CID | 162298378 |
| Molecular Formula | C31H48SSi |
| Molecular Weight | 480.88 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | [4-(4-tert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(4,5-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane |
| SMILES | CC1CC2C(c3ccc(C(C)(C)C)cc3)CCCC2C1[Si](C)(C)C1C(C)C(C)C2C=CSC21 |
| InChI | InChI=1S/C31H48SSi/c1-19-18-27-25(22-12-14-23(15-13-22)31(4,5)6)10-9-11-26(27)29(19)33(7,8)30-21(3)20(2)24-16-17-32-28(24)30/h12-17,19-21,24-30H,9-11,18H2,1-8H3 |
| InChIKey | IBAHVXXENCLCPT-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.88 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|