C36H50SSi — CID 89311878
[4-(4-tert-butylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(2,5-dimethyl-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane (PubChem CID 89311878) has the molecular formula C36H50SSi and a molecular weight of 542.95 g/mol. Its IUPAC name is [4-(4-tert-butylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(2,5-dimethyl-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane.
| Compound Name | [4-(4-tert-butylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(2,5-dimethyl-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane |
|---|---|
| PubChem CID | 89311878 |
| Molecular Formula | C36H50SSi |
| Molecular Weight | 542.95 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | [4-(4-tert-butylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(2,5-dimethyl-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane |
| SMILES | CC1=C(c2ccccc2)C2CC(C)C([Si](C)(C)C3CCC4C(c5ccc(C(C)(C)C)cc5)CCCC43)C2S1 |
| InChI | InChI=1S/C36H50SSi/c1-23-22-31-33(26-12-9-8-10-13-26)24(2)37-34(31)35(23)38(6,7)32-21-20-29-28(14-11-15-30(29)32)25-16-18-27(19-17-25)36(3,4)5/h8-10,12-13,16-19,23,28-32,34-35H,11,14-15,20-22H2,1-7H3 |
| InChIKey | ZLLBWGUINBNXNP-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.95 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|