C33H61NOSi — CID 156623942
cyclopentyl-(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane (PubChem CID 156623942) has the molecular formula C33H61NOSi and a molecular weight of 515.94 g/mol. Its IUPAC name is cyclopentyl-(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane.
| Compound Name | cyclopentyl-(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
|---|---|
| PubChem CID | 156623942 |
| Molecular Formula | C33H61NOSi |
| Molecular Weight | 515.94 g/mol |
| Exact Mass | 515.45 |
| IUPAC Name | cyclopentyl-(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
| SMILES | CC1CCC2C(C1)C1C(C3CCCCC3C1[Si](C)(CCCCCCOC(C)(C)C)C1CCCC1)N2C |
| InChI | InChI=1S/C33H61NOSi/c1-24-19-20-29-28(23-24)30-31(34(29)5)26-17-11-12-18-27(26)32(30)36(6,25-15-9-10-16-25)22-14-8-7-13-21-35-33(2,3)4/h24-32H,7-23H2,1-6H3 |
| InChIKey | YQDZWCFVXAIGQE-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.94 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|